C33H41Cl4N5O4 — CID 177489530
3,5-dichloro-N-[(2Z)-3-(3,4-dichlorophenyl)-5-[4-[3-[2-(dimethylamino)-2-oxoethyl]-2-oxopiperidin-1-yl]piperidin-1-yl]-2-hydroxyiminopentyl]-N-methylbenzamide (PubChem CID 177489530) has the molecular formula C33H41Cl4N5O4 and a molecular weight of 713.53 g/mol. Its IUPAC name is 3,5-dichloro-N-[(2Z)-3-(3,4-dichlorophenyl)-5-[4-[3-[2-(dimethylamino)-2-oxoethyl]-2-oxopiperidin-1-yl]piperidin-1-yl]-2-hydroxyiminopentyl]-N-methylbenzamide.
| Compound Name | 3,5-dichloro-N-[(2Z)-3-(3,4-dichlorophenyl)-5-[4-[3-[2-(dimethylamino)-2-oxoethyl]-2-oxopiperidin-1-yl]piperidin-1-yl]-2-hydroxyiminopentyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 177489530 |
| Molecular Formula | C33H41Cl4N5O4 |
| Molecular Weight | 713.53 g/mol |
| Exact Mass | 711.19 |
| IUPAC Name | 3,5-dichloro-N-[(2Z)-3-(3,4-dichlorophenyl)-5-[4-[3-[2-(dimethylamino)-2-oxoethyl]-2-oxopiperidin-1-yl]piperidin-1-yl]-2-hydroxyiminopentyl]-N-methylbenzamide |
| SMILES | CN(C)C(=O)CC1CCCN(C2CCN(CCC(/C(CN(C)C(=O)c3cc(Cl)cc(Cl)c3)=N/O)c3ccc(Cl)c(Cl)c3)CC2)C1=O |
| InChI | InChI=1S/C33H41Cl4N5O4/c1-39(2)31(43)18-22-5-4-11-42(33(22)45)26-8-12-41(13-9-26)14-10-27(21-6-7-28(36)29(37)17-21)30(38-46)20-40(3)32(44)23-15-24(34)19-25(35)16-23/h6-7,15-17,19,22,26-27,46H,4-5,8-14,18,20H2,1-3H3/b38-30+ |
| InChIKey | TYZGWDFRKZYDSU-BIXQXLNPSA-N |
| XLogP | 6.56 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.53 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|