C31H37Cl4N5O4 — CID 102379523
N-[(2Z,3S)-5-[4-[3-(2-amino-2-oxoethyl)-2-oxopiperidin-1-yl]piperidin-1-yl]-3-(3,4-dichlorophenyl)-2-hydroxyiminopentyl]-3,5-dichloro-N-methylbenzamide (PubChem CID 102379523) has the molecular formula C31H37Cl4N5O4 and a molecular weight of 685.48 g/mol. Its IUPAC name is N-[(2Z,3S)-5-[4-[3-(2-amino-2-oxoethyl)-2-oxopiperidin-1-yl]piperidin-1-yl]-3-(3,4-dichlorophenyl)-2-hydroxyiminopentyl]-3,5-dichloro-N-methylbenzamide.
| Compound Name | N-[(2Z,3S)-5-[4-[3-(2-amino-2-oxoethyl)-2-oxopiperidin-1-yl]piperidin-1-yl]-3-(3,4-dichlorophenyl)-2-hydroxyiminopentyl]-3,5-dichloro-N-methylbenzamide |
|---|---|
| PubChem CID | 102379523 |
| Molecular Formula | C31H37Cl4N5O4 |
| Molecular Weight | 685.48 g/mol |
| Exact Mass | 683.16 |
| IUPAC Name | N-[(2Z,3S)-5-[4-[3-(2-amino-2-oxoethyl)-2-oxopiperidin-1-yl]piperidin-1-yl]-3-(3,4-dichlorophenyl)-2-hydroxyiminopentyl]-3,5-dichloro-N-methylbenzamide |
| SMILES | CN(C/C(=N\O)[C@@H](CCN1CCC(N2CCCC(CC(N)=O)C2=O)CC1)c1ccc(Cl)c(Cl)c1)C(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C31H37Cl4N5O4/c1-38(30(42)21-13-22(32)17-23(33)14-21)18-28(37-44)25(19-4-5-26(34)27(35)15-19)8-12-39-10-6-24(7-11-39)40-9-2-3-20(31(40)43)16-29(36)41/h4-5,13-15,17,20,24-25,44H,2-3,6-12,16,18H2,1H3,(H2,36,41)/b37-28+/t20?,25-/m0/s1 |
| InChIKey | STQSRXPOBVIWQN-BLAOIZINSA-N |
| XLogP | 5.95 |
| TPSA | 119.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.48 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|