C35H49N5O5 — CID 10121849
2-[3-[1-[(4Z)-5-[(3,5-dimethylbenzoyl)-methylamino]-4-methoxyimino-3-phenylpentyl]piperidin-4-yl]-2-oxo-1,3-diazinan-1-yl]-2-methylpropanoic acid (PubChem CID 10121849) has the molecular formula C35H49N5O5 and a molecular weight of 619.81 g/mol. Its IUPAC name is 2-[3-[1-[(4Z)-5-[(3,5-dimethylbenzoyl)-methylamino]-4-methoxyimino-3-phenylpentyl]piperidin-4-yl]-2-oxo-1,3-diazinan-1-yl]-2-methylpropanoic acid.
| Compound Name | 2-[3-[1-[(4Z)-5-[(3,5-dimethylbenzoyl)-methylamino]-4-methoxyimino-3-phenylpentyl]piperidin-4-yl]-2-oxo-1,3-diazinan-1-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 10121849 |
| Molecular Formula | C35H49N5O5 |
| Molecular Weight | 619.81 g/mol |
| Exact Mass | 619.37 |
| IUPAC Name | 2-[3-[1-[(4Z)-5-[(3,5-dimethylbenzoyl)-methylamino]-4-methoxyimino-3-phenylpentyl]piperidin-4-yl]-2-oxo-1,3-diazinan-1-yl]-2-methylpropanoic acid |
| SMILES | CO/N=C(\CN(C)C(=O)c1cc(C)cc(C)c1)C(CCN1CCC(N2CCCN(C(C)(C)C(=O)O)C2=O)CC1)c1ccccc1 |
| InChI | InChI=1S/C35H49N5O5/c1-25-21-26(2)23-28(22-25)32(41)37(5)24-31(36-45-6)30(27-11-8-7-9-12-27)15-20-38-18-13-29(14-19-38)39-16-10-17-40(34(39)44)35(3,4)33(42)43/h7-9,11-12,21-23,29-30H,10,13-20,24H2,1-6H3,(H,42,43)/b36-31+ |
| InChIKey | DOOROYFHEWOFOA-XKMRCYARSA-N |
| XLogP | 5.01 |
| TPSA | 105.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.81 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|