C36H38F6N2O3S — CID 172943138
1-[(4Z)-5-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-(4,5-dihydro-1-benzothiophen-3-yl)-4-prop-2-enoxyiminopentyl]-4-phenylpiperidin-4-ol (PubChem CID 172943138) has the molecular formula C36H38F6N2O3S and a molecular weight of 692.77 g/mol. Its IUPAC name is 1-[(4Z)-5-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-(4,5-dihydro-1-benzothiophen-3-yl)-4-prop-2-enoxyiminopentyl]-4-phenylpiperidin-4-ol.
| Compound Name | 1-[(4Z)-5-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-(4,5-dihydro-1-benzothiophen-3-yl)-4-prop-2-enoxyiminopentyl]-4-phenylpiperidin-4-ol |
|---|---|
| PubChem CID | 172943138 |
| Molecular Formula | C36H38F6N2O3S |
| Molecular Weight | 692.77 g/mol |
| Exact Mass | 692.25 |
| IUPAC Name | 1-[(4Z)-5-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-(4,5-dihydro-1-benzothiophen-3-yl)-4-prop-2-enoxyiminopentyl]-4-phenylpiperidin-4-ol |
| SMILES | C=CCO/N=C(\COCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(CCN1CCC(O)(c2ccccc2)CC1)c1csc2c1CCC=C2 |
| InChI | InChI=1S/C36H38F6N2O3S/c1-2-18-47-43-32(23-46-22-25-19-27(35(37,38)39)21-28(20-25)36(40,41)42)29(31-24-48-33-11-7-6-10-30(31)33)12-15-44-16-13-34(45,14-17-44)26-8-4-3-5-9-26/h2-5,7-9,11,19-21,24,29,45H,1,6,10,12-18,22-23H2/b43-32+ |
| InChIKey | YMIAIVMXZUQYMS-WUGRJRDASA-N |
| XLogP | 8.98 |
| TPSA | 54.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.77 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|