C11H11NO — CID 74961331
5-methyl-3-prop-1-enyl-1,2-benzoxazole (PubChem CID 74961331) has the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. Its IUPAC name is 5-methyl-3-prop-1-enyl-1,2-benzoxazole.
| Compound Name | 5-methyl-3-prop-1-enyl-1,2-benzoxazole |
|---|---|
| PubChem CID | 74961331 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 5-methyl-3-prop-1-enyl-1,2-benzoxazole |
| SMILES | CC=Cc1noc2ccc(C)cc12 |
| InChI | InChI=1S/C11H11NO/c1-3-4-10-9-7-8(2)5-6-11(9)13-12-10/h3-7H,1-2H3 |
| InChIKey | GQLWQBGABAIAFG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |