C18H23NO4S — CID 749702
ethyl 2-[(4,4-dimethyl-2,6-dioxocyclohexyl)methylideneamino]-4,5-dimethylthiophene-3-carboxylate (PubChem CID 749702) has the molecular formula C18H23NO4S and a molecular weight of 349.45 g/mol. Its IUPAC name is ethyl 2-[(4,4-dimethyl-2,6-dioxocyclohexyl)methylideneamino]-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[(4,4-dimethyl-2,6-dioxocyclohexyl)methylideneamino]-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 749702 |
| Molecular Formula | C18H23NO4S |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | ethyl 2-[(4,4-dimethyl-2,6-dioxocyclohexyl)methylideneamino]-4,5-dimethylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(N=CC2C(=O)CC(C)(C)CC2=O)sc(C)c1C |
| InChI | InChI=1S/C18H23NO4S/c1-6-23-17(22)15-10(2)11(3)24-16(15)19-9-12-13(20)7-18(4,5)8-14(12)21/h9,12H,6-8H2,1-5H3 |
| InChIKey | VUSYZTWJLNVIJE-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|