C20H30N3O4S+ — CID 7497813
[(1R)-2-[(3,4-dimethoxyphenyl)sulfonylamino]-1-[4-(dimethylamino)phenyl]ethyl]-dimethylazanium (PubChem CID 7497813) has the molecular formula C20H30N3O4S+ and a molecular weight of 408.54 g/mol. Its IUPAC name is [(1R)-2-[(3,4-dimethoxyphenyl)sulfonylamino]-1-[4-(dimethylamino)phenyl]ethyl]-dimethylazanium.
| Compound Name | [(1R)-2-[(3,4-dimethoxyphenyl)sulfonylamino]-1-[4-(dimethylamino)phenyl]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 7497813 |
| Molecular Formula | C20H30N3O4S+ |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | [(1R)-2-[(3,4-dimethoxyphenyl)sulfonylamino]-1-[4-(dimethylamino)phenyl]ethyl]-dimethylazanium |
| SMILES | COc1ccc(S(=O)(=O)NC[C@@H](c2ccc(N(C)C)cc2)[NH+](C)C)cc1OC |
| InChI | InChI=1S/C20H29N3O4S/c1-22(2)16-9-7-15(8-10-16)18(23(3)4)14-21-28(24,25)17-11-12-19(26-5)20(13-17)27-6/h7-13,18,21H,14H2,1-6H3/p+1/t18-/m0/s1 |
| InChIKey | RXOMVNPONLWTKJ-SFHVURJKSA-O |
| XLogP | 0.93 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|