C20H30N3O2S+ — CID 7497827
[(1R)-1-[4-(dimethylamino)phenyl]-2-[(4-ethylphenyl)sulfonylamino]ethyl]-dimethylazanium (PubChem CID 7497827) has the molecular formula C20H30N3O2S+ and a molecular weight of 376.55 g/mol. Its IUPAC name is [(1R)-1-[4-(dimethylamino)phenyl]-2-[(4-ethylphenyl)sulfonylamino]ethyl]-dimethylazanium.
| Compound Name | [(1R)-1-[4-(dimethylamino)phenyl]-2-[(4-ethylphenyl)sulfonylamino]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 7497827 |
| Molecular Formula | C20H30N3O2S+ |
| Molecular Weight | 376.55 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | [(1R)-1-[4-(dimethylamino)phenyl]-2-[(4-ethylphenyl)sulfonylamino]ethyl]-dimethylazanium |
| SMILES | CCc1ccc(S(=O)(=O)NC[C@@H](c2ccc(N(C)C)cc2)[NH+](C)C)cc1 |
| InChI | InChI=1S/C20H29N3O2S/c1-6-16-7-13-19(14-8-16)26(24,25)21-15-20(23(4)5)17-9-11-18(12-10-17)22(2)3/h7-14,20-21H,6,15H2,1-5H3/p+1/t20-/m0/s1 |
| InChIKey | FVJPRVAFAZLEGJ-FQEVSTJZSA-O |
| XLogP | 1.48 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.55 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|