C21H32N3O2S+ — CID 7497783
[(1R)-1-[4-(dimethylamino)phenyl]-2-[(2,4,5-trimethylphenyl)sulfonylamino]ethyl]-dimethylazanium (PubChem CID 7497783) has the molecular formula C21H32N3O2S+ and a molecular weight of 390.57 g/mol. Its IUPAC name is [(1R)-1-[4-(dimethylamino)phenyl]-2-[(2,4,5-trimethylphenyl)sulfonylamino]ethyl]-dimethylazanium.
| Compound Name | [(1R)-1-[4-(dimethylamino)phenyl]-2-[(2,4,5-trimethylphenyl)sulfonylamino]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 7497783 |
| Molecular Formula | C21H32N3O2S+ |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | [(1R)-1-[4-(dimethylamino)phenyl]-2-[(2,4,5-trimethylphenyl)sulfonylamino]ethyl]-dimethylazanium |
| SMILES | Cc1cc(C)c(S(=O)(=O)NC[C@@H](c2ccc(N(C)C)cc2)[NH+](C)C)cc1C |
| InChI | InChI=1S/C21H31N3O2S/c1-15-12-17(3)21(13-16(15)2)27(25,26)22-14-20(24(6)7)18-8-10-19(11-9-18)23(4)5/h8-13,20,22H,14H2,1-7H3/p+1/t20-/m0/s1 |
| InChIKey | VHJQHGDVWNPKFZ-FQEVSTJZSA-O |
| XLogP | 1.84 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|