C13H16N4O7S3 — CID 74996971
2-methoxyethyl 3-[(3-methyl-5-sulfamoyl-1,3,4-thiadiazol-2-ylidene)amino]sulfonylbenzoate (PubChem CID 74996971) has the molecular formula C13H16N4O7S3 and a molecular weight of 436.49 g/mol. Its IUPAC name is 2-methoxyethyl 3-[(3-methyl-5-sulfamoyl-1,3,4-thiadiazol-2-ylidene)amino]sulfonylbenzoate.
| Compound Name | 2-methoxyethyl 3-[(3-methyl-5-sulfamoyl-1,3,4-thiadiazol-2-ylidene)amino]sulfonylbenzoate |
|---|---|
| PubChem CID | 74996971 |
| Molecular Formula | C13H16N4O7S3 |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.02 |
| IUPAC Name | 2-methoxyethyl 3-[(3-methyl-5-sulfamoyl-1,3,4-thiadiazol-2-ylidene)amino]sulfonylbenzoate |
| SMILES | COCCOC(=O)c1cccc(S(=O)(=O)N=c2sc(S(N)(=O)=O)nn2C)c1 |
| InChI | InChI=1S/C13H16N4O7S3/c1-17-12(25-13(15-17)26(14,19)20)16-27(21,22)10-5-3-4-9(8-10)11(18)24-7-6-23-2/h3-5,8H,6-7H2,1-2H3,(H2,14,19,20) |
| InChIKey | GPUZIHLGFQGDPQ-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 160.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|