C11H14N2O — CID 75009780
3-[(5-methyl-1,2-dihydropyrrol-5-yl)methoxy]pyridine (PubChem CID 75009780) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 3-[(5-methyl-1,2-dihydropyrrol-5-yl)methoxy]pyridine.
| Compound Name | 3-[(5-methyl-1,2-dihydropyrrol-5-yl)methoxy]pyridine |
|---|---|
| PubChem CID | 75009780 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 3-[(5-methyl-1,2-dihydropyrrol-5-yl)methoxy]pyridine |
| SMILES | CC1(COc2cccnc2)C=CCN1 |
| InChI | InChI=1S/C11H14N2O/c1-11(5-3-7-13-11)9-14-10-4-2-6-12-8-10/h2-6,8,13H,7,9H2,1H3 |
| InChIKey | FMTFDGYDXZUOGU-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|