C13H22Cl2N2O — CID 67586328
3-[[(2S)-2-propan-2-ylpyrrolidin-2-yl]methoxy]pyridine;dihydrochloride (PubChem CID 67586328) has the molecular formula C13H22Cl2N2O and a molecular weight of 293.24 g/mol. Its IUPAC name is 3-[[(2S)-2-propan-2-ylpyrrolidin-2-yl]methoxy]pyridine;dihydrochloride.
| Compound Name | 3-[[(2S)-2-propan-2-ylpyrrolidin-2-yl]methoxy]pyridine;dihydrochloride |
|---|---|
| PubChem CID | 67586328 |
| Molecular Formula | C13H22Cl2N2O |
| Molecular Weight | 293.24 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 3-[[(2S)-2-propan-2-ylpyrrolidin-2-yl]methoxy]pyridine;dihydrochloride |
| SMILES | CC(C)[C@]1(COc2cccnc2)CCCN1.Cl.Cl |
| InChI | InChI=1S/C13H20N2O.2ClH/c1-11(2)13(6-4-8-15-13)10-16-12-5-3-7-14-9-12;;/h3,5,7,9,11,15H,4,6,8,10H2,1-2H3;2*1H/t13-;;/m1../s1 |
| InChIKey | PXJXUJJNGXACKO-FFXKMJQXSA-N |
| XLogP | 3.08 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.24 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |