C15H26N2O5 — CID 75018256
3-amino-4-[1-(cyclohexanecarbonyloxy)butan-2-ylamino]-4-oxobutanoic acid (PubChem CID 75018256) has the molecular formula C15H26N2O5 and a molecular weight of 314.38 g/mol. Its IUPAC name is 3-amino-4-[1-(cyclohexanecarbonyloxy)butan-2-ylamino]-4-oxobutanoic acid.
| Compound Name | 3-amino-4-[1-(cyclohexanecarbonyloxy)butan-2-ylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 75018256 |
| Molecular Formula | C15H26N2O5 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | 3-amino-4-[1-(cyclohexanecarbonyloxy)butan-2-ylamino]-4-oxobutanoic acid |
| SMILES | CCC(COC(=O)C1CCCCC1)NC(=O)C(N)CC(=O)O |
| InChI | InChI=1S/C15H26N2O5/c1-2-11(17-14(20)12(16)8-13(18)19)9-22-15(21)10-6-4-3-5-7-10/h10-12H,2-9,16H2,1H3,(H,17,20)(H,18,19) |
| InChIKey | GAEFWMZOHRFHFI-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |