C11H14O5 — CID 75037337
2-(3,5-dioxo-4-pentyloxolan-2-ylidene)acetic acid (PubChem CID 75037337) has the molecular formula C11H14O5 and a molecular weight of 226.23 g/mol. Its IUPAC name is 2-(3,5-dioxo-4-pentyloxolan-2-ylidene)acetic acid.
| Compound Name | 2-(3,5-dioxo-4-pentyloxolan-2-ylidene)acetic acid |
|---|---|
| PubChem CID | 75037337 |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 2-(3,5-dioxo-4-pentyloxolan-2-ylidene)acetic acid |
| SMILES | CCCCCC1C(=O)OC(=CC(=O)O)C1=O |
| InChI | InChI=1S/C11H14O5/c1-2-3-4-5-7-10(14)8(6-9(12)13)16-11(7)15/h6-7H,2-5H2,1H3,(H,12,13) |
| InChIKey | NUAMJJPOAAYGOH-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|