C16H14ClF2NO5S — CID 7503766
2-[(2Z)-2-(2-ethoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-3-yl]ethyl 2-chloro-4,5-difluorobenzoate (PubChem CID 7503766) has the molecular formula C16H14ClF2NO5S and a molecular weight of 405.81 g/mol. Its IUPAC name is 2-[(2Z)-2-(2-ethoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-3-yl]ethyl 2-chloro-4,5-difluorobenzoate.
| Compound Name | 2-[(2Z)-2-(2-ethoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-3-yl]ethyl 2-chloro-4,5-difluorobenzoate |
|---|---|
| PubChem CID | 7503766 |
| Molecular Formula | C16H14ClF2NO5S |
| Molecular Weight | 405.81 g/mol |
| Exact Mass | 405.02 |
| IUPAC Name | 2-[(2Z)-2-(2-ethoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-3-yl]ethyl 2-chloro-4,5-difluorobenzoate |
| SMILES | CCOC(=O)/C=C1\SCC(=O)N1CCOC(=O)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C16H14ClF2NO5S/c1-2-24-15(22)7-14-20(13(21)8-26-14)3-4-25-16(23)9-5-11(18)12(19)6-10(9)17/h5-7H,2-4,8H2,1H3/b14-7- |
| InChIKey | MSDKWZTWXMTPPW-AUWJEWJLSA-N |
| XLogP | 2.75 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.81 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|