C16H16FNO5S — CID 7503805
2-[(2Z)-2-(2-ethoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-3-yl]ethyl 3-fluorobenzoate (PubChem CID 7503805) has the molecular formula C16H16FNO5S and a molecular weight of 353.37 g/mol. Its IUPAC name is 2-[(2Z)-2-(2-ethoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-3-yl]ethyl 3-fluorobenzoate.
| Compound Name | 2-[(2Z)-2-(2-ethoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-3-yl]ethyl 3-fluorobenzoate |
|---|---|
| PubChem CID | 7503805 |
| Molecular Formula | C16H16FNO5S |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | 2-[(2Z)-2-(2-ethoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-3-yl]ethyl 3-fluorobenzoate |
| SMILES | CCOC(=O)/C=C1\SCC(=O)N1CCOC(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C16H16FNO5S/c1-2-22-15(20)9-14-18(13(19)10-24-14)6-7-23-16(21)11-4-3-5-12(17)8-11/h3-5,8-9H,2,6-7,10H2,1H3/b14-9- |
| InChIKey | KIRRTHXDRHSEOW-ZROIWOOFSA-N |
| XLogP | 1.96 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|