C26H25NO10 — CID 75046940
[6-cyano-4a,8,8-trimethyl-7-oxo-2-(3,4,5-trihydroxyphenyl)-2,3,4,8a-tetrahydrochromen-3-yl] 3,4,5-trihydroxybenzoate (PubChem CID 75046940) has the molecular formula C26H25NO10 and a molecular weight of 511.48 g/mol. Its IUPAC name is [6-cyano-4a,8,8-trimethyl-7-oxo-2-(3,4,5-trihydroxyphenyl)-2,3,4,8a-tetrahydrochromen-3-yl] 3,4,5-trihydroxybenzoate.
| Compound Name | [6-cyano-4a,8,8-trimethyl-7-oxo-2-(3,4,5-trihydroxyphenyl)-2,3,4,8a-tetrahydrochromen-3-yl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 75046940 |
| Molecular Formula | C26H25NO10 |
| Molecular Weight | 511.48 g/mol |
| Exact Mass | 511.15 |
| IUPAC Name | [6-cyano-4a,8,8-trimethyl-7-oxo-2-(3,4,5-trihydroxyphenyl)-2,3,4,8a-tetrahydrochromen-3-yl] 3,4,5-trihydroxybenzoate |
| SMILES | CC12C=C(C#N)C(=O)C(C)(C)C1OC(c1cc(O)c(O)c(O)c1)C(OC(=O)c1cc(O)c(O)c(O)c1)C2 |
| InChI | InChI=1S/C26H25NO10/c1-25(2)22(34)13(10-27)8-26(3)9-18(36-23(35)12-6-16(30)20(33)17(31)7-12)21(37-24(25)26)11-4-14(28)19(32)15(29)5-11/h4-8,18,21,24,28-33H,9H2,1-3H3 |
| InChIKey | FKCCNRWDHUQPOJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 197.77 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.48 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|