C16H24N6O6 — CID 75064437
ethyl 4-[N'-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]piperazine-1-carboxylate;oxalic acid (PubChem CID 75064437) has the molecular formula C16H24N6O6 and a molecular weight of 396.40 g/mol. Its IUPAC name is ethyl 4-[N'-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]piperazine-1-carboxylate;oxalic acid.
| Compound Name | ethyl 4-[N'-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]piperazine-1-carboxylate;oxalic acid |
|---|---|
| PubChem CID | 75064437 |
| Molecular Formula | C16H24N6O6 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | ethyl 4-[N'-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]piperazine-1-carboxylate;oxalic acid |
| SMILES | CCOC(=O)N1CCN(C(N)=Nc2nc(C)cc(C)n2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C14H22N6O2.C2H2O4/c1-4-22-14(21)20-7-5-19(6-8-20)12(15)18-13-16-10(2)9-11(3)17-13;3-1(4)2(5)6/h9H,4-8H2,1-3H3,(H2,15,16,17,18);(H,3,4)(H,5,6) |
| InChIKey | BANZKTVUSUHQRH-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 171.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|