C14H17N3O2 — CID 75068971
methyl 2-diazo-2-[2-(2,2-dimethylpropylideneamino)phenyl]acetate (PubChem CID 75068971) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is methyl 2-diazo-2-[2-(2,2-dimethylpropylideneamino)phenyl]acetate.
| Compound Name | methyl 2-diazo-2-[2-(2,2-dimethylpropylideneamino)phenyl]acetate |
|---|---|
| PubChem CID | 75068971 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | methyl 2-diazo-2-[2-(2,2-dimethylpropylideneamino)phenyl]acetate |
| SMILES | COC(=O)C(=[N+]=[N-])c1ccccc1/N=C/C(C)(C)C |
| InChI | InChI=1S/C14H17N3O2/c1-14(2,3)9-16-11-8-6-5-7-10(11)12(17-15)13(18)19-4/h5-9H,1-4H3/b16-9+ |
| InChIKey | JQIZZMOFCCAWTJ-CXUHLZMHSA-N |
| XLogP | 2.63 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|