C33H39N3O6 — CID 75091936
N-[[3,5,14-trihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-10-yl]methylideneamino]quinoline-2-carboxamide (PubChem CID 75091936) has the molecular formula C33H39N3O6 and a molecular weight of 573.69 g/mol. Its IUPAC name is N-[[3,5,14-trihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-10-yl]methylideneamino]quinoline-2-carboxamide.
| Compound Name | N-[[3,5,14-trihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-10-yl]methylideneamino]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 75091936 |
| Molecular Formula | C33H39N3O6 |
| Molecular Weight | 573.69 g/mol |
| Exact Mass | 573.28 |
| IUPAC Name | N-[[3,5,14-trihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-10-yl]methylideneamino]quinoline-2-carboxamide |
| SMILES | CC12CCC3C(CCC4(O)CC(O)CCC34C=NNC(=O)c3ccc4ccccc4n3)C1(O)CCC2C1=CC(=O)OC1 |
| InChI | InChI=1S/C33H39N3O6/c1-30-12-9-24-25(33(30,41)15-11-23(30)21-16-28(38)42-18-21)10-14-32(40)17-22(37)8-13-31(24,32)19-34-36-29(39)27-7-6-20-4-2-3-5-26(20)35-27/h2-7,16,19,22-25,37,40-41H,8-15,17-18H2,1H3,(H,36,39) |
| InChIKey | XFMJRLJCUHDBBO-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 141.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.69 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|