C29H40O10 — CID 75110908
9,10,19,22-tetrahydroxy-7,18-dimethyl-19-(5-oxo-2H-furan-3-yl)-4,6,11-trioxahexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacosane-14-carbaldehyde (PubChem CID 75110908) has the molecular formula C29H40O10 and a molecular weight of 548.63 g/mol. Its IUPAC name is 9,10,19,22-tetrahydroxy-7,18-dimethyl-19-(5-oxo-2H-furan-3-yl)-4,6,11-trioxahexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacosane-14-carbaldehyde.
| Compound Name | 9,10,19,22-tetrahydroxy-7,18-dimethyl-19-(5-oxo-2H-furan-3-yl)-4,6,11-trioxahexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacosane-14-carbaldehyde |
|---|---|
| PubChem CID | 75110908 |
| Molecular Formula | C29H40O10 |
| Molecular Weight | 548.63 g/mol |
| Exact Mass | 548.26 |
| IUPAC Name | 9,10,19,22-tetrahydroxy-7,18-dimethyl-19-(5-oxo-2H-furan-3-yl)-4,6,11-trioxahexacyclo[12.11.0.03,12.05,10.015,23.018,22]pentacosane-14-carbaldehyde |
| SMILES | CC1CC(O)C2(O)OC3CC4(C=O)C(CCC5C4CCC4(C)C(O)(C6=CC(=O)OC6)CCC54O)CC3OC2O1 |
| InChI | InChI=1S/C29H40O10/c1-15-9-22(31)29(35)24(37-15)38-20-10-16-3-4-19-18(26(16,14-30)12-21(20)39-29)5-6-25(2)27(33,7-8-28(19,25)34)17-11-23(32)36-13-17/h11,14-16,18-22,24,31,33-35H,3-10,12-13H2,1-2H3 |
| InChIKey | ZROMRLOBUYCHGL-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.63 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|