C8H13NO4 — CID 75114276
5-(carboxymethyl)-2-methylpyrrolidine-2-carboxylic acid (PubChem CID 75114276) has the molecular formula C8H13NO4 and a molecular weight of 187.19 g/mol. Its IUPAC name is 5-(carboxymethyl)-2-methylpyrrolidine-2-carboxylic acid.
| Compound Name | 5-(carboxymethyl)-2-methylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 75114276 |
| Molecular Formula | C8H13NO4 |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 5-(carboxymethyl)-2-methylpyrrolidine-2-carboxylic acid |
| SMILES | CC1(C(=O)O)CCC(CC(=O)O)N1 |
| InChI | InChI=1S/C8H13NO4/c1-8(7(12)13)3-2-5(9-8)4-6(10)11/h5,9H,2-4H2,1H3,(H,10,11)(H,12,13) |
| InChIKey | RNCMEHTXTFFBQW-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |