C20H23N5O4S2 — CID 75118703
2-[[2-(3,4-dimethoxyphenyl)-4-oxo-2,3,3a,5-tetrahydro-1H-pyrazolo[1,5-d][1,2,4]triazin-7-yl]sulfanyl]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 75118703) has the molecular formula C20H23N5O4S2 and a molecular weight of 461.57 g/mol. Its IUPAC name is 2-[[2-(3,4-dimethoxyphenyl)-4-oxo-2,3,3a,5-tetrahydro-1H-pyrazolo[1,5-d][1,2,4]triazin-7-yl]sulfanyl]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[[2-(3,4-dimethoxyphenyl)-4-oxo-2,3,3a,5-tetrahydro-1H-pyrazolo[1,5-d][1,2,4]triazin-7-yl]sulfanyl]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 75118703 |
| Molecular Formula | C20H23N5O4S2 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | 2-[[2-(3,4-dimethoxyphenyl)-4-oxo-2,3,3a,5-tetrahydro-1H-pyrazolo[1,5-d][1,2,4]triazin-7-yl]sulfanyl]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | COc1ccc(C2CC3C(=O)NN=C(SCC(=O)NCc4cccs4)N3N2)cc1OC |
| InChI | InChI=1S/C20H23N5O4S2/c1-28-16-6-5-12(8-17(16)29-2)14-9-15-19(27)22-23-20(25(15)24-14)31-11-18(26)21-10-13-4-3-7-30-13/h3-8,14-15,24H,9-11H2,1-2H3,(H,21,26)(H,22,27) |
| InChIKey | ICKJJMUHEQZJNE-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |