C21H22FN5O4S — CID 74526608
N-(2,4-dimethoxyphenyl)-2-[[2-(4-fluorophenyl)-4-oxo-2,3,3a,5-tetrahydro-1H-pyrazolo[1,5-d][1,2,4]triazin-7-yl]sulfanyl]acetamide (PubChem CID 74526608) has the molecular formula C21H22FN5O4S and a molecular weight of 459.50 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-2-[[2-(4-fluorophenyl)-4-oxo-2,3,3a,5-tetrahydro-1H-pyrazolo[1,5-d][1,2,4]triazin-7-yl]sulfanyl]acetamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-2-[[2-(4-fluorophenyl)-4-oxo-2,3,3a,5-tetrahydro-1H-pyrazolo[1,5-d][1,2,4]triazin-7-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 74526608 |
| Molecular Formula | C21H22FN5O4S |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-2-[[2-(4-fluorophenyl)-4-oxo-2,3,3a,5-tetrahydro-1H-pyrazolo[1,5-d][1,2,4]triazin-7-yl]sulfanyl]acetamide |
| SMILES | COc1ccc(NC(=O)CSC2=NNC(=O)C3CC(c4ccc(F)cc4)NN23)c(OC)c1 |
| InChI | InChI=1S/C21H22FN5O4S/c1-30-14-7-8-15(18(9-14)31-2)23-19(28)11-32-21-25-24-20(29)17-10-16(26-27(17)21)12-3-5-13(22)6-4-12/h3-9,16-17,26H,10-11H2,1-2H3,(H,23,28)(H,24,29) |
| InChIKey | WGAWTGQXUDCSOJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |