C16H14ClFN4OS2 — CID 75118709
7-[(2-chloro-6-fluorophenyl)methylsulfanyl]-2-thiophen-2-yl-2,3,3a,5-tetrahydro-1H-pyrazolo[1,5-d][1,2,4]triazin-4-one (PubChem CID 75118709) has the molecular formula C16H14ClFN4OS2 and a molecular weight of 396.90 g/mol. Its IUPAC name is 7-[(2-chloro-6-fluorophenyl)methylsulfanyl]-2-thiophen-2-yl-2,3,3a,5-tetrahydro-1H-pyrazolo[1,5-d][1,2,4]triazin-4-one.
| Compound Name | 7-[(2-chloro-6-fluorophenyl)methylsulfanyl]-2-thiophen-2-yl-2,3,3a,5-tetrahydro-1H-pyrazolo[1,5-d][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 75118709 |
| Molecular Formula | C16H14ClFN4OS2 |
| Molecular Weight | 396.90 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | 7-[(2-chloro-6-fluorophenyl)methylsulfanyl]-2-thiophen-2-yl-2,3,3a,5-tetrahydro-1H-pyrazolo[1,5-d][1,2,4]triazin-4-one |
| SMILES | O=C1NN=C(SCc2c(F)cccc2Cl)N2NC(c3cccs3)CC12 |
| InChI | InChI=1S/C16H14ClFN4OS2/c17-10-3-1-4-11(18)9(10)8-25-16-20-19-15(23)13-7-12(21-22(13)16)14-5-2-6-24-14/h1-6,12-13,21H,7-8H2,(H,19,23) |
| InChIKey | WNLLHPIVYZNUMK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.90 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |