C22H26O5 — CID 75130849
(4,7,17-trimethyl-13-methylidene-3,9,19-trioxahexacyclo[13.3.1.01,15.02,4.05,14.06,10]nonadeca-6(10),7-dien-16-yl) acetate (PubChem CID 75130849) has the molecular formula C22H26O5 and a molecular weight of 370.45 g/mol. Its IUPAC name is (4,7,17-trimethyl-13-methylidene-3,9,19-trioxahexacyclo[13.3.1.01,15.02,4.05,14.06,10]nonadeca-6(10),7-dien-16-yl) acetate.
| Compound Name | (4,7,17-trimethyl-13-methylidene-3,9,19-trioxahexacyclo[13.3.1.01,15.02,4.05,14.06,10]nonadeca-6(10),7-dien-16-yl) acetate |
|---|---|
| PubChem CID | 75130849 |
| Molecular Formula | C22H26O5 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | (4,7,17-trimethyl-13-methylidene-3,9,19-trioxahexacyclo[13.3.1.01,15.02,4.05,14.06,10]nonadeca-6(10),7-dien-16-yl) acetate |
| SMILES | C=C1CCc2occ(C)c2C2C1C13OC1(CC(C)C3OC(C)=O)C1OC21C |
| InChI | InChI=1S/C22H26O5/c1-10-6-7-14-15(12(3)9-24-14)17-16(10)22-18(25-13(4)23)11(2)8-21(22,27-22)19-20(17,5)26-19/h9,11,16-19H,1,6-8H2,2-5H3 |
| InChIKey | XUGOJFTWXOCTSX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 64.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|