C18H24ClN3O3 — CID 75138329
ethyl 1-[5-(2-chlorophenyl)pyrazolidine-3-carbonyl]piperidine-4-carboxylate (PubChem CID 75138329) has the molecular formula C18H24ClN3O3 and a molecular weight of 365.86 g/mol. Its IUPAC name is ethyl 1-[5-(2-chlorophenyl)pyrazolidine-3-carbonyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[5-(2-chlorophenyl)pyrazolidine-3-carbonyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 75138329 |
| Molecular Formula | C18H24ClN3O3 |
| Molecular Weight | 365.86 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | ethyl 1-[5-(2-chlorophenyl)pyrazolidine-3-carbonyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)C2CC(c3ccccc3Cl)NN2)CC1 |
| InChI | InChI=1S/C18H24ClN3O3/c1-2-25-18(24)12-7-9-22(10-8-12)17(23)16-11-15(20-21-16)13-5-3-4-6-14(13)19/h3-6,12,15-16,20-21H,2,7-11H2,1H3 |
| InChIKey | CEBPGCYEKHSURF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.86 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |