C27H21FN4O2S2 — CID 75138370
2-[3-(4-fluorophenyl)-4-phenyl-1,3-thiazol-2-ylidene]-3-oxo-3-[4-(thiophene-2-carbonyl)piperazin-1-yl]propanenitrile (PubChem CID 75138370) has the molecular formula C27H21FN4O2S2 and a molecular weight of 516.62 g/mol. Its IUPAC name is 2-[3-(4-fluorophenyl)-4-phenyl-1,3-thiazol-2-ylidene]-3-oxo-3-[4-(thiophene-2-carbonyl)piperazin-1-yl]propanenitrile.
| Compound Name | 2-[3-(4-fluorophenyl)-4-phenyl-1,3-thiazol-2-ylidene]-3-oxo-3-[4-(thiophene-2-carbonyl)piperazin-1-yl]propanenitrile |
|---|---|
| PubChem CID | 75138370 |
| Molecular Formula | C27H21FN4O2S2 |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.11 |
| IUPAC Name | 2-[3-(4-fluorophenyl)-4-phenyl-1,3-thiazol-2-ylidene]-3-oxo-3-[4-(thiophene-2-carbonyl)piperazin-1-yl]propanenitrile |
| SMILES | N#CC(C(=O)N1CCN(C(=O)c2cccs2)CC1)=C1SC=C(c2ccccc2)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C27H21FN4O2S2/c28-20-8-10-21(11-9-20)32-23(19-5-2-1-3-6-19)18-36-27(32)22(17-29)25(33)30-12-14-31(15-13-30)26(34)24-7-4-16-35-24/h1-11,16,18H,12-15H2 |
| InChIKey | WAEAYTVOVSBELF-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 67.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|