C28H30N4O4S — CID 42816241
(2Z)-3-(4-butanoylpiperazin-1-yl)-2-[4-(3-methoxyphenyl)-3-(4-methoxyphenyl)-1,3-thiazol-2-ylidene]-3-oxopropanenitrile (PubChem CID 42816241) has the molecular formula C28H30N4O4S and a molecular weight of 518.64 g/mol. Its IUPAC name is (2Z)-3-(4-butanoylpiperazin-1-yl)-2-[4-(3-methoxyphenyl)-3-(4-methoxyphenyl)-1,3-thiazol-2-ylidene]-3-oxopropanenitrile.
| Compound Name | (2Z)-3-(4-butanoylpiperazin-1-yl)-2-[4-(3-methoxyphenyl)-3-(4-methoxyphenyl)-1,3-thiazol-2-ylidene]-3-oxopropanenitrile |
|---|---|
| PubChem CID | 42816241 |
| Molecular Formula | C28H30N4O4S |
| Molecular Weight | 518.64 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | (2Z)-3-(4-butanoylpiperazin-1-yl)-2-[4-(3-methoxyphenyl)-3-(4-methoxyphenyl)-1,3-thiazol-2-ylidene]-3-oxopropanenitrile |
| SMILES | CCCC(=O)N1CCN(C(=O)/C(C#N)=C2\SC=C(c3cccc(OC)c3)N2c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C28H30N4O4S/c1-4-6-26(33)30-13-15-31(16-14-30)27(34)24(18-29)28-32(21-9-11-22(35-2)12-10-21)25(19-37-28)20-7-5-8-23(17-20)36-3/h5,7-12,17,19H,4,6,13-16H2,1-3H3/b28-24- |
| InChIKey | KUFUHAMIVRJBBO-COOPMVRXSA-N |
| XLogP | 4.46 |
| TPSA | 86.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.64 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|