C18H18N2O5S — CID 6008833
ethyl (2Z)-2-(1-cyano-2-ethoxy-2-oxoethylidene)-3-(4-methoxyphenyl)-1,3-thiazole-4-carboxylate (PubChem CID 6008833) has the molecular formula C18H18N2O5S and a molecular weight of 374.42 g/mol. Its IUPAC name is ethyl (2Z)-2-(1-cyano-2-ethoxy-2-oxoethylidene)-3-(4-methoxyphenyl)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl (2Z)-2-(1-cyano-2-ethoxy-2-oxoethylidene)-3-(4-methoxyphenyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 6008833 |
| Molecular Formula | C18H18N2O5S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | ethyl (2Z)-2-(1-cyano-2-ethoxy-2-oxoethylidene)-3-(4-methoxyphenyl)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)C1=CS/C(=C(/C#N)C(=O)OCC)N1c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H18N2O5S/c1-4-24-17(21)14(10-19)16-20(12-6-8-13(23-3)9-7-12)15(11-26-16)18(22)25-5-2/h6-9,11H,4-5H2,1-3H3/b16-14- |
| InChIKey | ZTKMISVZMYRRKV-PEZBUJJGSA-N |
| XLogP | 2.95 |
| TPSA | 88.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|