C27H21N3O3S — CID 155490766
ethyl 4-[[2-cyano-2-(3,4-diphenyl-1,3-thiazol-2-ylidene)acetyl]amino]benzoate (PubChem CID 155490766) has the molecular formula C27H21N3O3S and a molecular weight of 467.55 g/mol. Its IUPAC name is ethyl 4-[[2-cyano-2-(3,4-diphenyl-1,3-thiazol-2-ylidene)acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-cyano-2-(3,4-diphenyl-1,3-thiazol-2-ylidene)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 155490766 |
| Molecular Formula | C27H21N3O3S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | ethyl 4-[[2-cyano-2-(3,4-diphenyl-1,3-thiazol-2-ylidene)acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C(C#N)=C2SC=C(c3ccccc3)N2c2ccccc2)cc1 |
| InChI | InChI=1S/C27H21N3O3S/c1-2-33-27(32)20-13-15-21(16-14-20)29-25(31)23(17-28)26-30(22-11-7-4-8-12-22)24(18-34-26)19-9-5-3-6-10-19/h3-16,18H,2H2,1H3,(H,29,31) |
| InChIKey | NTOGBWUPMZMSTQ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|