C21H19NO3S — CID 18529632
ethyl (2E)-2-(3,4-diphenyl-1,3-thiazol-2-ylidene)-3-oxobutanoate (PubChem CID 18529632) has the molecular formula C21H19NO3S and a molecular weight of 365.45 g/mol. Its IUPAC name is ethyl (2E)-2-(3,4-diphenyl-1,3-thiazol-2-ylidene)-3-oxobutanoate.
| Compound Name | ethyl (2E)-2-(3,4-diphenyl-1,3-thiazol-2-ylidene)-3-oxobutanoate |
|---|---|
| PubChem CID | 18529632 |
| Molecular Formula | C21H19NO3S |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | ethyl (2E)-2-(3,4-diphenyl-1,3-thiazol-2-ylidene)-3-oxobutanoate |
| SMILES | CCOC(=O)/C(C(C)=O)=C1/SC=C(c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C21H19NO3S/c1-3-25-21(24)19(15(2)23)20-22(17-12-8-5-9-13-17)18(14-26-20)16-10-6-4-7-11-16/h4-14H,3H2,1-2H3/b20-19+ |
| InChIKey | DTNCHHVUIWDLCJ-FMQUCBEESA-N |
| XLogP | 4.60 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|