C24H20N4O2S — CID 18531239
ethyl (2E)-2-[4-amino-5-cyano-3-(4-methylphenyl)-6-phenyl-1,3-thiazepin-2-ylidene]-2-cyanoacetate (PubChem CID 18531239) has the molecular formula C24H20N4O2S and a molecular weight of 428.52 g/mol. Its IUPAC name is ethyl (2E)-2-[4-amino-5-cyano-3-(4-methylphenyl)-6-phenyl-1,3-thiazepin-2-ylidene]-2-cyanoacetate.
| Compound Name | ethyl (2E)-2-[4-amino-5-cyano-3-(4-methylphenyl)-6-phenyl-1,3-thiazepin-2-ylidene]-2-cyanoacetate |
|---|---|
| PubChem CID | 18531239 |
| Molecular Formula | C24H20N4O2S |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | ethyl (2E)-2-[4-amino-5-cyano-3-(4-methylphenyl)-6-phenyl-1,3-thiazepin-2-ylidene]-2-cyanoacetate |
| SMILES | CCOC(=O)/C(C#N)=C1/SC=C(c2ccccc2)C(C#N)=C(N)N1c1ccc(C)cc1 |
| InChI | InChI=1S/C24H20N4O2S/c1-3-30-24(29)20(14-26)23-28(18-11-9-16(2)10-12-18)22(27)19(13-25)21(15-31-23)17-7-5-4-6-8-17/h4-12,15H,3,27H2,1-2H3/b23-20+ |
| InChIKey | BWTAZUUSWGIWGQ-BSYVCWPDSA-N |
| XLogP | 4.58 |
| TPSA | 103.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|