C28H29ClN4O2S — CID 71957145
2-[3-(3-chlorophenyl)-4-(4-methylphenyl)-1,3-thiazol-2-ylidene]-3-[4-(3-methylbutanoyl)piperazin-1-yl]-3-oxopropanenitrile (PubChem CID 71957145) has the molecular formula C28H29ClN4O2S and a molecular weight of 521.09 g/mol. Its IUPAC name is 2-[3-(3-chlorophenyl)-4-(4-methylphenyl)-1,3-thiazol-2-ylidene]-3-[4-(3-methylbutanoyl)piperazin-1-yl]-3-oxopropanenitrile.
| Compound Name | 2-[3-(3-chlorophenyl)-4-(4-methylphenyl)-1,3-thiazol-2-ylidene]-3-[4-(3-methylbutanoyl)piperazin-1-yl]-3-oxopropanenitrile |
|---|---|
| PubChem CID | 71957145 |
| Molecular Formula | C28H29ClN4O2S |
| Molecular Weight | 521.09 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | 2-[3-(3-chlorophenyl)-4-(4-methylphenyl)-1,3-thiazol-2-ylidene]-3-[4-(3-methylbutanoyl)piperazin-1-yl]-3-oxopropanenitrile |
| SMILES | Cc1ccc(C2=CSC(=C(C#N)C(=O)N3CCN(C(=O)CC(C)C)CC3)N2c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C28H29ClN4O2S/c1-19(2)15-26(34)31-11-13-32(14-12-31)27(35)24(17-30)28-33(23-6-4-5-22(29)16-23)25(18-36-28)21-9-7-20(3)8-10-21/h4-10,16,18-19H,11-15H2,1-3H3 |
| InChIKey | LWOPLAUVBQWKNI-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 67.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.09 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|