C30H34N4O3S — CID 71957146
3-[4-(3,3-dimethylbutanoyl)piperazin-1-yl]-2-[4-(3-methoxyphenyl)-3-(4-methylphenyl)-1,3-thiazol-2-ylidene]-3-oxopropanenitrile (PubChem CID 71957146) has the molecular formula C30H34N4O3S and a molecular weight of 530.69 g/mol. Its IUPAC name is 3-[4-(3,3-dimethylbutanoyl)piperazin-1-yl]-2-[4-(3-methoxyphenyl)-3-(4-methylphenyl)-1,3-thiazol-2-ylidene]-3-oxopropanenitrile.
| Compound Name | 3-[4-(3,3-dimethylbutanoyl)piperazin-1-yl]-2-[4-(3-methoxyphenyl)-3-(4-methylphenyl)-1,3-thiazol-2-ylidene]-3-oxopropanenitrile |
|---|---|
| PubChem CID | 71957146 |
| Molecular Formula | C30H34N4O3S |
| Molecular Weight | 530.69 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | 3-[4-(3,3-dimethylbutanoyl)piperazin-1-yl]-2-[4-(3-methoxyphenyl)-3-(4-methylphenyl)-1,3-thiazol-2-ylidene]-3-oxopropanenitrile |
| SMILES | COc1cccc(C2=CSC(=C(C#N)C(=O)N3CCN(C(=O)CC(C)(C)C)CC3)N2c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C30H34N4O3S/c1-21-9-11-23(12-10-21)34-26(22-7-6-8-24(17-22)37-5)20-38-29(34)25(19-31)28(36)33-15-13-32(14-16-33)27(35)18-30(2,3)4/h6-12,17,20H,13-16,18H2,1-5H3 |
| InChIKey | LFEGEOXDHKJIEY-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 76.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.69 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|