C24H25N5OS — CID 54379638
2-[3-[4-(dimethylamino)phenyl]-4-phenyl-1,3-thiazol-2-ylidene]-3-oxo-3-piperazin-1-ylpropanenitrile (PubChem CID 54379638) has the molecular formula C24H25N5OS and a molecular weight of 431.57 g/mol. Its IUPAC name is 2-[3-[4-(dimethylamino)phenyl]-4-phenyl-1,3-thiazol-2-ylidene]-3-oxo-3-piperazin-1-ylpropanenitrile.
| Compound Name | 2-[3-[4-(dimethylamino)phenyl]-4-phenyl-1,3-thiazol-2-ylidene]-3-oxo-3-piperazin-1-ylpropanenitrile |
|---|---|
| PubChem CID | 54379638 |
| Molecular Formula | C24H25N5OS |
| Molecular Weight | 431.57 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 2-[3-[4-(dimethylamino)phenyl]-4-phenyl-1,3-thiazol-2-ylidene]-3-oxo-3-piperazin-1-ylpropanenitrile |
| SMILES | CN(C)c1ccc(N2C(c3ccccc3)=CSC2=C(C#N)C(=O)N2CCNCC2)cc1 |
| InChI | InChI=1S/C24H25N5OS/c1-27(2)19-8-10-20(11-9-19)29-22(18-6-4-3-5-7-18)17-31-24(29)21(16-25)23(30)28-14-12-26-13-15-28/h3-11,17,26H,12-15H2,1-2H3 |
| InChIKey | UYZZEZFXSBXUAG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 62.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.57 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|