C27H27ClN4O2S — CID 71957262
2-[3-(3-chlorophenyl)-4-phenyl-1,3-thiazol-2-ylidene]-3-[4-(3-methylbutanoyl)piperazin-1-yl]-3-oxopropanenitrile (PubChem CID 71957262) has the molecular formula C27H27ClN4O2S and a molecular weight of 507.06 g/mol. Its IUPAC name is 2-[3-(3-chlorophenyl)-4-phenyl-1,3-thiazol-2-ylidene]-3-[4-(3-methylbutanoyl)piperazin-1-yl]-3-oxopropanenitrile.
| Compound Name | 2-[3-(3-chlorophenyl)-4-phenyl-1,3-thiazol-2-ylidene]-3-[4-(3-methylbutanoyl)piperazin-1-yl]-3-oxopropanenitrile |
|---|---|
| PubChem CID | 71957262 |
| Molecular Formula | C27H27ClN4O2S |
| Molecular Weight | 507.06 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | 2-[3-(3-chlorophenyl)-4-phenyl-1,3-thiazol-2-ylidene]-3-[4-(3-methylbutanoyl)piperazin-1-yl]-3-oxopropanenitrile |
| SMILES | CC(C)CC(=O)N1CCN(C(=O)C(C#N)=C2SC=C(c3ccccc3)N2c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C27H27ClN4O2S/c1-19(2)15-25(33)30-11-13-31(14-12-30)26(34)23(17-29)27-32(22-10-6-9-21(28)16-22)24(18-35-27)20-7-4-3-5-8-20/h3-10,16,18-19H,11-15H2,1-2H3 |
| InChIKey | JQEGUEIJYZUEJP-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 67.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.06 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|