C22H19FN4O3S2 — CID 75164484
2-[[3-[3-[(6-fluoro-1,3-benzothiazol-2-yl)amino]phenyl]-1,2-oxazole-5-carbothioyl]amino]-3-methylbutanoic acid (PubChem CID 75164484) has the molecular formula C22H19FN4O3S2 and a molecular weight of 470.55 g/mol. Its IUPAC name is 2-[[3-[3-[(6-fluoro-1,3-benzothiazol-2-yl)amino]phenyl]-1,2-oxazole-5-carbothioyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[3-[3-[(6-fluoro-1,3-benzothiazol-2-yl)amino]phenyl]-1,2-oxazole-5-carbothioyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 75164484 |
| Molecular Formula | C22H19FN4O3S2 |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | 2-[[3-[3-[(6-fluoro-1,3-benzothiazol-2-yl)amino]phenyl]-1,2-oxazole-5-carbothioyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)C(NC(=S)c1cc(-c2cccc(Nc3nc4ccc(F)cc4s3)c2)no1)C(=O)O |
| InChI | InChI=1S/C22H19FN4O3S2/c1-11(2)19(21(28)29)26-20(31)17-10-16(27-30-17)12-4-3-5-14(8-12)24-22-25-15-7-6-13(23)9-18(15)32-22/h3-11,19H,1-2H3,(H,24,25)(H,26,31)(H,28,29) |
| InChIKey | WMANYSVJHDATEY-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 100.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|