C22H20FN5O4S — CID 135862940
(2S)-2-[[[3-[3-[(6-fluoro-1,3-benzothiazol-2-yl)amino]phenyl]-1,2-oxazol-5-yl]-(hydroxyamino)methylidene]amino]-3-methylbutanoic acid (PubChem CID 135862940) has the molecular formula C22H20FN5O4S and a molecular weight of 469.50 g/mol. Its IUPAC name is (2S)-2-[[[3-[3-[(6-fluoro-1,3-benzothiazol-2-yl)amino]phenyl]-1,2-oxazol-5-yl]-(hydroxyamino)methylidene]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[[3-[3-[(6-fluoro-1,3-benzothiazol-2-yl)amino]phenyl]-1,2-oxazol-5-yl]-(hydroxyamino)methylidene]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 135862940 |
| Molecular Formula | C22H20FN5O4S |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | (2S)-2-[[[3-[3-[(6-fluoro-1,3-benzothiazol-2-yl)amino]phenyl]-1,2-oxazol-5-yl]-(hydroxyamino)methylidene]amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](/N=C(\NO)c1cc(-c2cccc(Nc3nc4ccc(F)cc4s3)c2)no1)C(=O)O |
| InChI | InChI=1S/C22H20FN5O4S/c1-11(2)19(21(29)30)26-20(27-31)17-10-16(28-32-17)12-4-3-5-14(8-12)24-22-25-15-7-6-13(23)9-18(15)33-22/h3-11,19,31H,1-2H3,(H,24,25)(H,26,27)(H,29,30)/t19-/m0/s1 |
| InChIKey | BOXKXNTTWWWELF-IBGZPJMESA-N |
| XLogP | 4.67 |
| TPSA | 132.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|