C26H19FN4O3S2 — CID 75164651
methyl 2-[[3-[4-[(6-fluoro-1,3-benzothiazol-2-yl)amino]phenyl]-1,2-oxazole-5-carbothioyl]amino]-2-phenylacetate (PubChem CID 75164651) has the molecular formula C26H19FN4O3S2 and a molecular weight of 518.60 g/mol. Its IUPAC name is methyl 2-[[3-[4-[(6-fluoro-1,3-benzothiazol-2-yl)amino]phenyl]-1,2-oxazole-5-carbothioyl]amino]-2-phenylacetate.
| Compound Name | methyl 2-[[3-[4-[(6-fluoro-1,3-benzothiazol-2-yl)amino]phenyl]-1,2-oxazole-5-carbothioyl]amino]-2-phenylacetate |
|---|---|
| PubChem CID | 75164651 |
| Molecular Formula | C26H19FN4O3S2 |
| Molecular Weight | 518.60 g/mol |
| Exact Mass | 518.09 |
| IUPAC Name | methyl 2-[[3-[4-[(6-fluoro-1,3-benzothiazol-2-yl)amino]phenyl]-1,2-oxazole-5-carbothioyl]amino]-2-phenylacetate |
| SMILES | COC(=O)C(NC(=S)c1cc(-c2ccc(Nc3nc4ccc(F)cc4s3)cc2)no1)c1ccccc1 |
| InChI | InChI=1S/C26H19FN4O3S2/c1-33-25(32)23(16-5-3-2-4-6-16)30-24(35)21-14-20(31-34-21)15-7-10-18(11-8-15)28-26-29-19-12-9-17(27)13-22(19)36-26/h2-14,23H,1H3,(H,28,29)(H,30,35) |
| InChIKey | SULOSOUPAZIKNN-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 89.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.60 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|