C26H40O6 — CID 75179831
4-O-[(7-hydroxy-1,4a,10a-trimethyl-9-oxo-7-propan-2-yl-3,4,4b,5,6,10-hexahydro-2H-phenanthren-1-yl)methyl] 1-O-methyl butanedioate (PubChem CID 75179831) has the molecular formula C26H40O6 and a molecular weight of 448.60 g/mol. Its IUPAC name is 4-O-[(7-hydroxy-1,4a,10a-trimethyl-9-oxo-7-propan-2-yl-3,4,4b,5,6,10-hexahydro-2H-phenanthren-1-yl)methyl] 1-O-methyl butanedioate.
| Compound Name | 4-O-[(7-hydroxy-1,4a,10a-trimethyl-9-oxo-7-propan-2-yl-3,4,4b,5,6,10-hexahydro-2H-phenanthren-1-yl)methyl] 1-O-methyl butanedioate |
|---|---|
| PubChem CID | 75179831 |
| Molecular Formula | C26H40O6 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | 4-O-[(7-hydroxy-1,4a,10a-trimethyl-9-oxo-7-propan-2-yl-3,4,4b,5,6,10-hexahydro-2H-phenanthren-1-yl)methyl] 1-O-methyl butanedioate |
| SMILES | COC(=O)CCC(=O)OCC1(C)CCCC2(C)C3CCC(O)(C(C)C)C=C3C(=O)CC12C |
| InChI | InChI=1S/C26H40O6/c1-17(2)26(30)13-10-19-18(14-26)20(27)15-25(5)23(3,11-7-12-24(19,25)4)16-32-22(29)9-8-21(28)31-6/h14,17,19,30H,7-13,15-16H2,1-6H3 |
| InChIKey | AHBQIYSLXQMIEO-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |