C26H43NO3 — CID 145341184
methyl 4-[(8S,17R)-9-amino-8,10,13-trimethyl-7-oxo-1,2,3,4,5,6,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 145341184) has the molecular formula C26H43NO3 and a molecular weight of 417.63 g/mol. Its IUPAC name is methyl 4-[(8S,17R)-9-amino-8,10,13-trimethyl-7-oxo-1,2,3,4,5,6,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methyl 4-[(8S,17R)-9-amino-8,10,13-trimethyl-7-oxo-1,2,3,4,5,6,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 145341184 |
| Molecular Formula | C26H43NO3 |
| Molecular Weight | 417.63 g/mol |
| Exact Mass | 417.32 |
| IUPAC Name | methyl 4-[(8S,17R)-9-amino-8,10,13-trimethyl-7-oxo-1,2,3,4,5,6,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | COC(=O)CCC(C)[C@H]1CCC2C1(C)CCC1(N)C3(C)CCCCC3CC(=O)[C@@]21C |
| InChI | InChI=1S/C26H43NO3/c1-17(9-12-22(29)30-5)19-10-11-20-23(19,2)14-15-26(27)24(3)13-7-6-8-18(24)16-21(28)25(20,26)4/h17-20H,6-16,27H2,1-5H3/t17?,18?,19-,20?,23?,24?,25-,26?/m1/s1 |
| InChIKey | RDBSJSUGMCUMJD-DMRYWTMMSA-N |
| XLogP | 5.28 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.63 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |