C26H43N3O3 — CID 162811862
methyl (4S)-4-[(5S,8S,9S,10S,13R,14S,17R)-7-(carbamoylhydrazinylidene)-10,13-dimethyl-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 162811862) has the molecular formula C26H43N3O3 and a molecular weight of 445.65 g/mol. Its IUPAC name is methyl (4S)-4-[(5S,8S,9S,10S,13R,14S,17R)-7-(carbamoylhydrazinylidene)-10,13-dimethyl-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methyl (4S)-4-[(5S,8S,9S,10S,13R,14S,17R)-7-(carbamoylhydrazinylidene)-10,13-dimethyl-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 162811862 |
| Molecular Formula | C26H43N3O3 |
| Molecular Weight | 445.65 g/mol |
| Exact Mass | 445.33 |
| IUPAC Name | methyl (4S)-4-[(5S,8S,9S,10S,13R,14S,17R)-7-(carbamoylhydrazinylidene)-10,13-dimethyl-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | COC(=O)CC[C@H](C)[C@H]1CC[C@H]2[C@H]3C(=NNC(N)=O)C[C@@H]4CCCC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C26H43N3O3/c1-16(8-11-22(30)32-4)18-9-10-19-23-20(12-14-26(18,19)3)25(2)13-6-5-7-17(25)15-21(23)28-29-24(27)31/h16-20,23H,5-15H2,1-4H3,(H3,27,29,31)/t16-,17-,18+,19-,20-,23+,25-,26+/m0/s1 |
| InChIKey | CQCNMHGZPMKDSP-GRTUMAEYSA-N |
| XLogP | 5.26 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.65 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|