C36H41ClN4O6 — CID 75185525
N-[2-(4-chlorophenyl)ethyl]-4-[[1-[2-[2-(3,4-dimethoxyphenyl)ethylamino]-2-oxoethyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydroquinazolin-3-yl]methyl]benzamide (PubChem CID 75185525) has the molecular formula C36H41ClN4O6 and a molecular weight of 661.20 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-4-[[1-[2-[2-(3,4-dimethoxyphenyl)ethylamino]-2-oxoethyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydroquinazolin-3-yl]methyl]benzamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-4-[[1-[2-[2-(3,4-dimethoxyphenyl)ethylamino]-2-oxoethyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydroquinazolin-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 75185525 |
| Molecular Formula | C36H41ClN4O6 |
| Molecular Weight | 661.20 g/mol |
| Exact Mass | 660.27 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-4-[[1-[2-[2-(3,4-dimethoxyphenyl)ethylamino]-2-oxoethyl]-2,4-dioxo-4a,5,6,7,8,8a-hexahydroquinazolin-3-yl]methyl]benzamide |
| SMILES | COc1ccc(CCNC(=O)CN2C(=O)N(Cc3ccc(C(=O)NCCc4ccc(Cl)cc4)cc3)C(=O)C3CCCCC32)cc1OC |
| InChI | InChI=1S/C36H41ClN4O6/c1-46-31-16-11-25(21-32(31)47-2)18-19-38-33(42)23-40-30-6-4-3-5-29(30)35(44)41(36(40)45)22-26-7-12-27(13-8-26)34(43)39-20-17-24-9-14-28(37)15-10-24/h7-16,21,29-30H,3-6,17-20,22-23H2,1-2H3,(H,38,42)(H,39,43) |
| InChIKey | UJBIPTHDTKDUSR-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.20 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |