C12H12BrFN2O2S2 — CID 7518657
1-bromo-N-[2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]ethyl]methanesulfonamide (PubChem CID 7518657) has the molecular formula C12H12BrFN2O2S2 and a molecular weight of 379.28 g/mol. Its IUPAC name is 1-bromo-N-[2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]ethyl]methanesulfonamide.
| Compound Name | 1-bromo-N-[2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 7518657 |
| Molecular Formula | C12H12BrFN2O2S2 |
| Molecular Weight | 379.28 g/mol |
| Exact Mass | 377.95 |
| IUPAC Name | 1-bromo-N-[2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]ethyl]methanesulfonamide |
| SMILES | O=S(=O)(CBr)NCCc1csc(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C12H12BrFN2O2S2/c13-8-20(17,18)15-6-5-11-7-19-12(16-11)9-1-3-10(14)4-2-9/h1-4,7,15H,5-6,8H2 |
| InChIKey | CLAOJXCCLRBJMB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.28 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|