C26H18ClFN4O3 — CID 75193888
5-[[2-(2-chlorophenyl)-3-oxo-5-phenyl-1H-pyrazol-4-yl]methylidene]-3-[(3-fluorophenyl)methyl]imidazolidine-2,4-dione (PubChem CID 75193888) has the molecular formula C26H18ClFN4O3 and a molecular weight of 488.91 g/mol. Its IUPAC name is 5-[[2-(2-chlorophenyl)-3-oxo-5-phenyl-1H-pyrazol-4-yl]methylidene]-3-[(3-fluorophenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5-[[2-(2-chlorophenyl)-3-oxo-5-phenyl-1H-pyrazol-4-yl]methylidene]-3-[(3-fluorophenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 75193888 |
| Molecular Formula | C26H18ClFN4O3 |
| Molecular Weight | 488.91 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | 5-[[2-(2-chlorophenyl)-3-oxo-5-phenyl-1H-pyrazol-4-yl]methylidene]-3-[(3-fluorophenyl)methyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=Cc2c(-c3ccccc3)[nH]n(-c3ccccc3Cl)c2=O)C(=O)N1Cc1cccc(F)c1 |
| InChI | InChI=1S/C26H18ClFN4O3/c27-20-11-4-5-12-22(20)32-24(33)19(23(30-32)17-8-2-1-3-9-17)14-21-25(34)31(26(35)29-21)15-16-7-6-10-18(28)13-16/h1-14,30H,15H2,(H,29,35) |
| InChIKey | ZFVLNUZNPDRTGB-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 87.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.91 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|