C26H18ClN5O5 — CID 75193959
5-[[2-(2-chlorophenyl)-3-oxo-5-phenyl-1H-pyrazol-4-yl]methylidene]-3-[(3-nitrophenyl)methyl]imidazolidine-2,4-dione (PubChem CID 75193959) has the molecular formula C26H18ClN5O5 and a molecular weight of 515.91 g/mol. Its IUPAC name is 5-[[2-(2-chlorophenyl)-3-oxo-5-phenyl-1H-pyrazol-4-yl]methylidene]-3-[(3-nitrophenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5-[[2-(2-chlorophenyl)-3-oxo-5-phenyl-1H-pyrazol-4-yl]methylidene]-3-[(3-nitrophenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 75193959 |
| Molecular Formula | C26H18ClN5O5 |
| Molecular Weight | 515.91 g/mol |
| Exact Mass | 515.10 |
| IUPAC Name | 5-[[2-(2-chlorophenyl)-3-oxo-5-phenyl-1H-pyrazol-4-yl]methylidene]-3-[(3-nitrophenyl)methyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=Cc2c(-c3ccccc3)[nH]n(-c3ccccc3Cl)c2=O)C(=O)N1Cc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H18ClN5O5/c27-20-11-4-5-12-22(20)31-24(33)19(23(29-31)17-8-2-1-3-9-17)14-21-25(34)30(26(35)28-21)15-16-7-6-10-18(13-16)32(36)37/h1-14,29H,15H2,(H,28,35) |
| InChIKey | TXAGLENWQSEKFM-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 130.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.91 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|