C24H22N4O3 — CID 7206030
(5Z)-5-[(2-benzyl-3-oxo-5-phenyl-1H-pyrazol-4-yl)methylidene]-3-but-3-enylimidazolidine-2,4-dione (PubChem CID 7206030) has the molecular formula C24H22N4O3 and a molecular weight of 414.47 g/mol. Its IUPAC name is (5Z)-5-[(2-benzyl-3-oxo-5-phenyl-1H-pyrazol-4-yl)methylidene]-3-but-3-enylimidazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(2-benzyl-3-oxo-5-phenyl-1H-pyrazol-4-yl)methylidene]-3-but-3-enylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 7206030 |
| Molecular Formula | C24H22N4O3 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | (5Z)-5-[(2-benzyl-3-oxo-5-phenyl-1H-pyrazol-4-yl)methylidene]-3-but-3-enylimidazolidine-2,4-dione |
| SMILES | C=CCCN1C(=O)N/C(=C\c2c(-c3ccccc3)[nH]n(Cc3ccccc3)c2=O)C1=O |
| InChI | InChI=1S/C24H22N4O3/c1-2-3-14-27-23(30)20(25-24(27)31)15-19-21(18-12-8-5-9-13-18)26-28(22(19)29)16-17-10-6-4-7-11-17/h2,4-13,15,26H,1,3,14,16H2,(H,25,31)/b20-15- |
| InChIKey | JSSYSLVFHBWVBG-HKWRFOASSA-N |
| XLogP | 3.36 |
| TPSA | 87.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|