C20H24N4O3 — CID 7205698
(5Z)-5-[(2-benzyl-5-ethyl-3-oxo-1H-pyrazol-4-yl)methylidene]-3-butylimidazolidine-2,4-dione (PubChem CID 7205698) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is (5Z)-5-[(2-benzyl-5-ethyl-3-oxo-1H-pyrazol-4-yl)methylidene]-3-butylimidazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(2-benzyl-5-ethyl-3-oxo-1H-pyrazol-4-yl)methylidene]-3-butylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 7205698 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | (5Z)-5-[(2-benzyl-5-ethyl-3-oxo-1H-pyrazol-4-yl)methylidene]-3-butylimidazolidine-2,4-dione |
| SMILES | CCCCN1C(=O)N/C(=C\c2c(CC)[nH]n(Cc3ccccc3)c2=O)C1=O |
| InChI | InChI=1S/C20H24N4O3/c1-3-5-11-23-19(26)17(21-20(23)27)12-15-16(4-2)22-24(18(15)25)13-14-9-7-6-8-10-14/h6-10,12,22H,3-5,11,13H2,1-2H3,(H,21,27)/b17-12- |
| InChIKey | AGTOEHHENQQVHO-ATVHPVEESA-N |
| XLogP | 2.48 |
| TPSA | 87.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|