C24H24N4O3 — CID 78460286
3-[(4-methylphenyl)methyl]-5-[(3-oxo-2-phenyl-5-propyl-1H-pyrazol-4-yl)methylidene]imidazolidine-2,4-dione (PubChem CID 78460286) has the molecular formula C24H24N4O3 and a molecular weight of 416.48 g/mol. Its IUPAC name is 3-[(4-methylphenyl)methyl]-5-[(3-oxo-2-phenyl-5-propyl-1H-pyrazol-4-yl)methylidene]imidazolidine-2,4-dione.
| Compound Name | 3-[(4-methylphenyl)methyl]-5-[(3-oxo-2-phenyl-5-propyl-1H-pyrazol-4-yl)methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 78460286 |
| Molecular Formula | C24H24N4O3 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 3-[(4-methylphenyl)methyl]-5-[(3-oxo-2-phenyl-5-propyl-1H-pyrazol-4-yl)methylidene]imidazolidine-2,4-dione |
| SMILES | CCCc1[nH]n(-c2ccccc2)c(=O)c1C=C1NC(=O)N(Cc2ccc(C)cc2)C1=O |
| InChI | InChI=1S/C24H24N4O3/c1-3-7-20-19(22(29)28(26-20)18-8-5-4-6-9-18)14-21-23(30)27(24(31)25-21)15-17-12-10-16(2)11-13-17/h4-6,8-14,26H,3,7,15H2,1-2H3,(H,25,31) |
| InChIKey | BSGIYLGWXNJNME-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 87.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|